{"name":"Intellect Fortress","spell_level":"1-level","school":"Illusion","classes":"Mystic","casting_time":"","range":"","duration":"","components":"","materials":"","requires_concentration":"","spell_description":"You forge an indomitable wall of psionic energy\u00a0around your mind\u2014one that allows you to\u00a0launch counterattacks against your opponents.\r\n\r\n[b]Psychic Focus.[\/b] While focused on this\u00a0discipline, you gain resistance to psychic\u00a0damage.\r\n\r\n[b]Psychic Backlash (2 psi)[\/b]. As a reaction, you\u00a0can impose disadvantage on an attack roll\u00a0against you if you can see the attacker. If the\u00a0attack still hits you, the attacker takes 2d10\u00a0psychic damage.\r\n\r\n[b]Psychic Parry (1\u20137 psi).[\/b] As a reaction when\u00a0you make an Intelligence, a Wisdom, or a\u00a0Charisma saving throw, you gain a +1 bonus to\u00a0that saving throw for each psi point you spend\u00a0on this ability. You can use this ability after\u00a0rolling the die but before suffering the results.\r\n\r\n[b]Psychic Redoubt (5 psi; conc., 10 min.)[\/b]. As an\u00a0action, you create a field of protective psychic\u00a0energy. Choose any number of creatures within\u00a030 feet of you. Until your concentration ends,\u00a0each target has resistance to psychic damage and\u00a0advantage on Intelligence, Wisdom, and\u00a0Charisma saving throws.\r\n","higher_levels":"","source":"","ritual":"","tags":"Mystic, Disciplines","templateId":"3000","blockId":"390637","isShared":"on"}