{"name":"Neko-mo","abilityscores":"When determining your character\u2019s ability scores, increase one score by 2 and increase a different score by 1, or increase three different scores by 1.","size":"Small","speed":"30ft","languages":"You can speak, read, and write Common and one other language of your choice.","features":"[b]Lore[\/b]\r\nNeko-mo's also known as the \"Helper Race\" are the small furry creatures of Dravokis, not much is knows about there past or there origin even they don't remember where they originated tho most don't really care. Neko-mo's are little helpers they assist all other creatures of Dravokis in there daily routines may it be Cleaning, Cooking, Farming, ect Neko-mo's are there to help, they do this because they have some innate impulse to just help, also helping usually means they get a roof over there head and free food. In Dravokis Neko-mo's are breaded and sold kind of like animals tho they don't seem bothered by this and accept it as there way of life they also don't speak normally and instead need to be taught to speak. Note if a player wants to play as a Neko-mo they must known that the world of Dravokis sees them as slaves or pets in a way also a PC Neko-mo can speak.\r\n\r\n[b]Darkvision[\/b]\r\nYou can see in dim light within 60 feet of you as if it were bright light, and in darkness as if it were dim light. You can\u2019t discern color in darkness, only shades of gray.\r\n\r\n[b]Skillful[\/b]\r\nYou gain two skill proficiencies of your choice.\r\n\r\n[b]Helping and Assisting[\/b]\r\nWhen a creature that is friendly to you is attempting to make a skill check or saving throw and are within 30ft of you, you can use your reaction to make that roll have advantage, you can do this after they roll but before the outcome. You can do this equal to your proficiency modifier which recharges on a long rest.\r\n\r\n[b]Small and Nimble[\/b]\r\nYou gain a climbing speed equal to your walking speed and moving through friendly creatures does not count as difficult terrain.\r\n\r\n[b]A Light Delight[\/b]\r\nWhile within 5ft of another creature if that creature is hit with an attack you may use your reaction to take that attack instead. You can do this equal to your Proficiency Modifier which charges on a long rest.\r\n\r\n\r\n\r\n","tabledata":"","tags":"","isShared":"on","templateId":"23","blockId":"390886","world":"c0257b64-92cf-4d00-bb3f-7250f4e52c26","folder":""}